C21H21F3N2O4 — CID 55803413
1-(2-methoxyphenyl)-5-oxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine-3-carboxamide (PubChem CID 55803413) has the molecular formula C21H21F3N2O4 and a molecular weight of 422.40 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-5-oxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(2-methoxyphenyl)-5-oxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55803413 |
| Molecular Formula | C21H21F3N2O4 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 1-(2-methoxyphenyl)-5-oxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine-3-carboxamide |
| SMILES | COc1ccccc1N1CC(C(=O)NCCOc2ccc(C(F)(F)F)cc2)CC1=O |
| InChI | InChI=1S/C21H21F3N2O4/c1-29-18-5-3-2-4-17(18)26-13-14(12-19(26)27)20(28)25-10-11-30-16-8-6-15(7-9-16)21(22,23)24/h2-9,14H,10-13H2,1H3,(H,25,28) |
| InChIKey | GDLKCQAHGAHBAG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|