C16H18F3NO3 — CID 154880254
oxiran-2-yl-[4-[[2-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]methanone (PubChem CID 154880254) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is oxiran-2-yl-[4-[[2-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]methanone.
| Compound Name | oxiran-2-yl-[4-[[2-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 154880254 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | oxiran-2-yl-[4-[[2-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]methanone |
| SMILES | O=C(C1CO1)N1CCC(COc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H18F3NO3/c17-16(18,19)12-3-1-2-4-13(12)22-9-11-5-7-20(8-6-11)15(21)14-10-23-14/h1-4,11,14H,5-10H2 |
| InChIKey | UOGFZGIGTKNJOA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|