C19H19F3N2O3 — CID 170364130
methyl 6-[3-[[2-(trifluoromethyl)phenoxy]methyl]pyrrolidin-1-yl]pyridine-2-carboxylate (PubChem CID 170364130) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is methyl 6-[3-[[2-(trifluoromethyl)phenoxy]methyl]pyrrolidin-1-yl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[3-[[2-(trifluoromethyl)phenoxy]methyl]pyrrolidin-1-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 170364130 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | methyl 6-[3-[[2-(trifluoromethyl)phenoxy]methyl]pyrrolidin-1-yl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(N2CCC(COc3ccccc3C(F)(F)F)C2)n1 |
| InChI | InChI=1S/C19H19F3N2O3/c1-26-18(25)15-6-4-8-17(23-15)24-10-9-13(11-24)12-27-16-7-3-2-5-14(16)19(20,21)22/h2-8,13H,9-12H2,1H3 |
| InChIKey | GIUKWSULDZECBX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |