C17H16F3N3O3 — CID 163972344
methyl 6-methyl-2-[3-[2-(trifluoromethyl)phenoxy]azetidin-1-yl]pyrimidine-4-carboxylate (PubChem CID 163972344) has the molecular formula C17H16F3N3O3 and a molecular weight of 367.33 g/mol. Its IUPAC name is methyl 6-methyl-2-[3-[2-(trifluoromethyl)phenoxy]azetidin-1-yl]pyrimidine-4-carboxylate.
| Compound Name | methyl 6-methyl-2-[3-[2-(trifluoromethyl)phenoxy]azetidin-1-yl]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 163972344 |
| Molecular Formula | C17H16F3N3O3 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | methyl 6-methyl-2-[3-[2-(trifluoromethyl)phenoxy]azetidin-1-yl]pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1cc(C)nc(N2CC(Oc3ccccc3C(F)(F)F)C2)n1 |
| InChI | InChI=1S/C17H16F3N3O3/c1-10-7-13(15(24)25-2)22-16(21-10)23-8-11(9-23)26-14-6-4-3-5-12(14)17(18,19)20/h3-7,11H,8-9H2,1-2H3 |
| InChIKey | SRBYPXIGSHMFQL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |