C20H25N3O3 — CID 170364036
2-[3-[(2-tert-butylphenoxy)methyl]azetidin-1-yl]-6-methylpyrimidine-4-carboxylic acid (PubChem CID 170364036) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[3-[(2-tert-butylphenoxy)methyl]azetidin-1-yl]-6-methylpyrimidine-4-carboxylic acid.
| Compound Name | 2-[3-[(2-tert-butylphenoxy)methyl]azetidin-1-yl]-6-methylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 170364036 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-[3-[(2-tert-butylphenoxy)methyl]azetidin-1-yl]-6-methylpyrimidine-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)nc(N2CC(COc3ccccc3C(C)(C)C)C2)n1 |
| InChI | InChI=1S/C20H25N3O3/c1-13-9-16(18(24)25)22-19(21-13)23-10-14(11-23)12-26-17-8-6-5-7-15(17)20(2,3)4/h5-9,14H,10-12H2,1-4H3,(H,24,25) |
| InChIKey | DHVHCLVXZDURIP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |