C21H22F3N5O3 — CID 86297823
methyl 2-[[(3aS,6aR)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]amino]-6-methylpyrimidine-4-carboxylate (PubChem CID 86297823) has the molecular formula C21H22F3N5O3 and a molecular weight of 449.43 g/mol. Its IUPAC name is methyl 2-[[(3aS,6aR)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]amino]-6-methylpyrimidine-4-carboxylate.
| Compound Name | methyl 2-[[(3aS,6aR)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]amino]-6-methylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 86297823 |
| Molecular Formula | C21H22F3N5O3 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | methyl 2-[[(3aS,6aR)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]amino]-6-methylpyrimidine-4-carboxylate |
| SMILES | COC(=O)c1cc(C)nc(NC(=O)N2C[C@@H]3CN(c4ccccc4C(F)(F)F)C[C@@H]3C2)n1 |
| InChI | InChI=1S/C21H22F3N5O3/c1-12-7-16(18(30)32-2)26-19(25-12)27-20(31)29-10-13-8-28(9-14(13)11-29)17-6-4-3-5-15(17)21(22,23)24/h3-7,13-14H,8-11H2,1-2H3,(H,25,26,27,31)/t13-,14+ |
| InChIKey | KJTZGIKHNJPUQC-OKILXGFUSA-N |
| XLogP | 3.19 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |