C11H13FN2O5S — CID 154880909
3-fluorosulfonyloxy-5-(oxane-2-carbonylamino)pyridine (PubChem CID 154880909) has the molecular formula C11H13FN2O5S and a molecular weight of 304.30 g/mol. Its IUPAC name is 3-fluorosulfonyloxy-5-(oxane-2-carbonylamino)pyridine.
| Compound Name | 3-fluorosulfonyloxy-5-(oxane-2-carbonylamino)pyridine |
|---|---|
| PubChem CID | 154880909 |
| Molecular Formula | C11H13FN2O5S |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 3-fluorosulfonyloxy-5-(oxane-2-carbonylamino)pyridine |
| SMILES | O=C(Nc1cncc(OS(=O)(=O)F)c1)C1CCCCO1 |
| InChI | InChI=1S/C11H13FN2O5S/c12-20(16,17)19-9-5-8(6-13-7-9)14-11(15)10-3-1-2-4-18-10/h5-7,10H,1-4H2,(H,14,15) |
| InChIKey | AJUUHUXFWHWAEJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |