About 3-fluoro-5,5-dimethyl-4-[(2-methylpropan-2-yl)oxy]furan-2-one
3-fluoro-5,5-dimethyl-4-[(2-methylpropan-2-yl)oxy]furan-2-one (PubChem CID 15488157) has the molecular formula C10H15FO3
and a molecular weight of 202.22 g/mol. Its IUPAC name is 3-fluoro-5,5-dimethyl-4-[(2-methylpropan-2-yl)oxy]furan-2-one.
Molecular Properties
| Compound Name | 3-fluoro-5,5-dimethyl-4-[(2-methylpropan-2-yl)oxy]furan-2-one |
| PubChem CID | 15488157 |
| Molecular Formula | C10H15FO3 |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 3-fluoro-5,5-dimethyl-4-[(2-methylpropan-2-yl)oxy]furan-2-one |
| SMILES | CC(C)(C)OC1=C(F)C(=O)OC1(C)C |
| InChI | InChI=1S/C10H15FO3/c1-9(2,3)13-7-6(11)8(12)14-10(7,4)5/h1-5H3 |
| InChIKey | MGTHOUIWMLISPD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-fluoro-5,5-dimethyl-4-[(2-methylpropan-2-yl)oxy]furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-5,5-dimethyl-4-[(2-methylpropan-2-yl)oxy]furan-2-one?
The IUPAC name of 3-fluoro-5,5-dimethyl-4-[(2-methylpropan-2-yl)oxy]furan-2-one (CID 15488157) is 3-fluoro-5,5-dimethyl-4-[(2-methylpropan-2-yl)oxy]furan-2-one.
What is the SMILES notation for 3-fluoro-5,5-dimethyl-4-[(2-methylpropan-2-yl)oxy]furan-2-one?
The canonical SMILES for 3-fluoro-5,5-dimethyl-4-[(2-methylpropan-2-yl)oxy]furan-2-one is CC(C)(C)OC1=C(F)C(=O)OC1(C)C.
What is the InChIKey of 3-fluoro-5,5-dimethyl-4-[(2-methylpropan-2-yl)oxy]furan-2-one?
The InChIKey is MGTHOUIWMLISPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15FO3/c1-9(2,3)13-7-6(11)8(12)14-10(7,4)5/h1-5H3.
What are the key properties of 3-fluoro-5,5-dimethyl-4-[(2-methylpropan-2-yl)oxy]furan-2-one?
3-fluoro-5,5-dimethyl-4-[(2-methylpropan-2-yl)oxy]furan-2-one has a molecular weight of 202.22 g/mol, XLogP of 2.32, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-5,5-dimethyl-4-[(2-methylpropan-2-yl)oxy]furan-2-one is sourced from PubChem (CID 15488157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).