C9H12O4 — CID 23253914
(2,2,4-trimethyl-5-oxofuran-3-yl) acetate (PubChem CID 23253914) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is (2,2,4-trimethyl-5-oxofuran-3-yl) acetate.
| Compound Name | (2,2,4-trimethyl-5-oxofuran-3-yl) acetate |
|---|---|
| PubChem CID | 23253914 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (2,2,4-trimethyl-5-oxofuran-3-yl) acetate |
| SMILES | CC(=O)OC1=C(C)C(=O)OC1(C)C |
| InChI | InChI=1S/C9H12O4/c1-5-7(12-6(2)10)9(3,4)13-8(5)11/h1-4H3 |
| InChIKey | FRNNXBRRVPSPBR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |