(2,4-dimethyl-5-oxo-2H-furan-3-yl) acetate

C8H10O4 — CID 536096

IUPAC(2,4-dimethyl-5-oxo-2H-furan-3-yl) acetate
SMILESCC(=O)OC1=C(C)C(=O)OC1C
InChIInChI=1S/C8H10O4/c1-4-7(12-6(3)9)5(2)11-8(4)10/h5H,1-3H3
InChIKeyOBQCRKRFVJMFQH-UHFFFAOYSA-N
MW170.16 g/mol
LogP0.77
Rot. Bonds1

About (2,4-dimethyl-5-oxo-2H-furan-3-yl) acetate

(2,4-dimethyl-5-oxo-2H-furan-3-yl) acetate (PubChem CID 536096) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is (2,4-dimethyl-5-oxo-2H-furan-3-yl) acetate.

Molecular Properties

Compound Name(2,4-dimethyl-5-oxo-2H-furan-3-yl) acetate
PubChem CID536096
Molecular FormulaC8H10O4
Molecular Weight170.16 g/mol
Exact Mass170.06
IUPAC Name(2,4-dimethyl-5-oxo-2H-furan-3-yl) acetate
SMILESCC(=O)OC1=C(C)C(=O)OC1C
InChIInChI=1S/C8H10O4/c1-4-7(12-6(3)9)5(2)11-8(4)10/h5H,1-3H3
InChIKeyOBQCRKRFVJMFQH-UHFFFAOYSA-N
XLogP0.77
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.16
LogP ≤ 50.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (2,4-dimethyl-5-oxo-2H-furan-3-yl) acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4-dimethyl-5-oxo-2H-furan-3-yl) acetate?
The IUPAC name of (2,4-dimethyl-5-oxo-2H-furan-3-yl) acetate (CID 536096) is (2,4-dimethyl-5-oxo-2H-furan-3-yl) acetate.
What is the SMILES notation for (2,4-dimethyl-5-oxo-2H-furan-3-yl) acetate?
The canonical SMILES for (2,4-dimethyl-5-oxo-2H-furan-3-yl) acetate is CC(=O)OC1=C(C)C(=O)OC1C.
What is the InChIKey of (2,4-dimethyl-5-oxo-2H-furan-3-yl) acetate?
The InChIKey is OBQCRKRFVJMFQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4/c1-4-7(12-6(3)9)5(2)11-8(4)10/h5H,1-3H3.
What are the key properties of (2,4-dimethyl-5-oxo-2H-furan-3-yl) acetate?
(2,4-dimethyl-5-oxo-2H-furan-3-yl) acetate has a molecular weight of 170.16 g/mol, XLogP of 0.77, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethyl-5-oxo-2H-furan-3-yl) acetate is sourced from PubChem (CID 536096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).