C8H12O4 — CID 11805203
3-(methoxymethoxy)-2,4-dimethyl-2H-furan-5-one (PubChem CID 11805203) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is 3-(methoxymethoxy)-2,4-dimethyl-2H-furan-5-one.
| Compound Name | 3-(methoxymethoxy)-2,4-dimethyl-2H-furan-5-one |
|---|---|
| PubChem CID | 11805203 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 3-(methoxymethoxy)-2,4-dimethyl-2H-furan-5-one |
| SMILES | COCOC1=C(C)C(=O)OC1C |
| InChI | InChI=1S/C8H12O4/c1-5-7(11-4-10-3)6(2)12-8(5)9/h6H,4H2,1-3H3 |
| InChIKey | DAUBFLVSADEXRJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|