C15H20ClNO2 — CID 154883606
tert-butyl 1-[(6-chloro-3-pyridinyl)methyl]cyclobutane-1-carboxylate (PubChem CID 154883606) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is tert-butyl 1-[(6-chloro-3-pyridinyl)methyl]cyclobutane-1-carboxylate.
| Compound Name | tert-butyl 1-[(6-chloro-3-pyridinyl)methyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 154883606 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | tert-butyl 1-[(6-chloro-3-pyridinyl)methyl]cyclobutane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(Cc2ccc(Cl)nc2)CCC1 |
| InChI | InChI=1S/C15H20ClNO2/c1-14(2,3)19-13(18)15(7-4-8-15)9-11-5-6-12(16)17-10-11/h5-6,10H,4,7-9H2,1-3H3 |
| InChIKey | GXVXKUPNQYRYKN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|