C15H23Cl2N5S — CID 154885577
4-N-(1-thiophen-2-ylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine;dihydrochloride (PubChem CID 154885577) has the molecular formula C15H23Cl2N5S and a molecular weight of 376.36 g/mol. Its IUPAC name is 4-N-(1-thiophen-2-ylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine;dihydrochloride.
| Compound Name | 4-N-(1-thiophen-2-ylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 154885577 |
| Molecular Formula | C15H23Cl2N5S |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 4-N-(1-thiophen-2-ylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine;dihydrochloride |
| SMILES | CCC(Nc1nc(N)nc2c1CCNCC2)c1cccs1.Cl.Cl |
| InChI | InChI=1S/C15H21N5S.2ClH/c1-2-11(13-4-3-9-21-13)18-14-10-5-7-17-8-6-12(10)19-15(16)20-14;;/h3-4,9,11,17H,2,5-8H2,1H3,(H3,16,18,19,20);2*1H |
| InChIKey | UPSCSVUUKFCSJU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |