C12H13F4N5S — CID 59874342
6-(1,2,2,2-tetrafluoroethyl)-2-N-(1-thiophen-2-ylpropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 59874342) has the molecular formula C12H13F4N5S and a molecular weight of 335.33 g/mol. Its IUPAC name is 6-(1,2,2,2-tetrafluoroethyl)-2-N-(1-thiophen-2-ylpropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1,2,2,2-tetrafluoroethyl)-2-N-(1-thiophen-2-ylpropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 59874342 |
| Molecular Formula | C12H13F4N5S |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 6-(1,2,2,2-tetrafluoroethyl)-2-N-(1-thiophen-2-ylpropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCC(Nc1nc(N)nc(C(F)C(F)(F)F)n1)c1cccs1 |
| InChI | InChI=1S/C12H13F4N5S/c1-2-6(7-4-3-5-22-7)18-11-20-9(19-10(17)21-11)8(13)12(14,15)16/h3-6,8H,2H2,1H3,(H3,17,18,19,20,21) |
| InChIKey | MURQGNGUDINVCA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |