C17H22F3N3O5 — CID 154885934
N-(3-imidazol-1-ylpropyl)-2-oxo-1-oxaspiro[4.4]nonane-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 154885934) has the molecular formula C17H22F3N3O5 and a molecular weight of 405.37 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2-oxo-1-oxaspiro[4.4]nonane-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2-oxo-1-oxaspiro[4.4]nonane-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154885934 |
| Molecular Formula | C17H22F3N3O5 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2-oxo-1-oxaspiro[4.4]nonane-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1CC(C(=O)NCCCn2ccnc2)C2(CCCC2)O1 |
| InChI | InChI=1S/C15H21N3O3.C2HF3O2/c19-13-10-12(15(21-13)4-1-2-5-15)14(20)17-6-3-8-18-9-7-16-11-18;3-2(4,5)1(6)7/h7,9,11-12H,1-6,8,10H2,(H,17,20);(H,6,7) |
| InChIKey | SZVRVMLPKZYIHG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|