C21H22F3N3O4S — CID 154887745
3-(furan-2-yl)-5-[[5-(oxolan-2-yl)thiophen-2-yl]methyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 154887745) has the molecular formula C21H22F3N3O4S and a molecular weight of 469.49 g/mol. Its IUPAC name is 3-(furan-2-yl)-5-[[5-(oxolan-2-yl)thiophen-2-yl]methyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(furan-2-yl)-5-[[5-(oxolan-2-yl)thiophen-2-yl]methyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154887745 |
| Molecular Formula | C21H22F3N3O4S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 3-(furan-2-yl)-5-[[5-(oxolan-2-yl)thiophen-2-yl]methyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1coc(-c2n[nH]c3c2CN(Cc2ccc(C4CCCO4)s2)CC3)c1 |
| InChI | InChI=1S/C19H21N3O2S.C2HF3O2/c1-3-16(23-9-1)18-6-5-13(25-18)11-22-8-7-15-14(12-22)19(21-20-15)17-4-2-10-24-17;3-2(4,5)1(6)7/h2,4-6,10,16H,1,3,7-9,11-12H2,(H,20,21);(H,6,7) |
| InChIKey | XWZKJEHVDUBDQK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |