C18H28Cl2N4O2 — CID 154888603
4-benzyl-2-(2-ethoxyethyl)-5-piperidin-4-yl-1,2,4-triazol-3-one;dihydrochloride (PubChem CID 154888603) has the molecular formula C18H28Cl2N4O2 and a molecular weight of 403.35 g/mol. Its IUPAC name is 4-benzyl-2-(2-ethoxyethyl)-5-piperidin-4-yl-1,2,4-triazol-3-one;dihydrochloride.
| Compound Name | 4-benzyl-2-(2-ethoxyethyl)-5-piperidin-4-yl-1,2,4-triazol-3-one;dihydrochloride |
|---|---|
| PubChem CID | 154888603 |
| Molecular Formula | C18H28Cl2N4O2 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 4-benzyl-2-(2-ethoxyethyl)-5-piperidin-4-yl-1,2,4-triazol-3-one;dihydrochloride |
| SMILES | CCOCCn1nc(C2CCNCC2)n(Cc2ccccc2)c1=O.Cl.Cl |
| InChI | InChI=1S/C18H26N4O2.2ClH/c1-2-24-13-12-22-18(23)21(14-15-6-4-3-5-7-15)17(20-22)16-8-10-19-11-9-16;;/h3-7,16,19H,2,8-14H2,1H3;2*1H |
| InChIKey | YRWCQOLPVFSHOO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|