About (2-benzyl-1,3-thiazol-4-yl)-(2,9-diazaspiro[4.5]decan-2-yl)methanone;hydrochloride
(2-benzyl-1,3-thiazol-4-yl)-(2,9-diazaspiro[4.5]decan-2-yl)methanone;hydrochloride (PubChem CID 154889666) has the molecular formula C19H24ClN3OS
and a molecular weight of 377.94 g/mol. Its IUPAC name is (2-benzyl-1,3-thiazol-4-yl)-(2,9-diazaspiro[4.5]decan-2-yl)methanone;hydrochloride.
Molecular Properties
| Compound Name | (2-benzyl-1,3-thiazol-4-yl)-(2,9-diazaspiro[4.5]decan-2-yl)methanone;hydrochloride |
| PubChem CID | 154889666 |
| Molecular Formula | C19H24ClN3OS |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (2-benzyl-1,3-thiazol-4-yl)-(2,9-diazaspiro[4.5]decan-2-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1csc(Cc2ccccc2)n1)N1CCC2(CCCNC2)C1 |
| InChI | InChI=1S/C19H23N3OS.ClH/c23-18(22-10-8-19(14-22)7-4-9-20-13-19)16-12-24-17(21-16)11-15-5-2-1-3-6-15;/h1-3,5-6,12,20H,4,7-11,13-14H2;1H |
| InChIKey | FEJFGJFMUOPHPT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-benzyl-1,3-thiazol-4-yl)-(2,9-diazaspiro[4.5]decan-2-yl)methanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzyl-1,3-thiazol-4-yl)-(2,9-diazaspiro[4.5]decan-2-yl)methanone;hydrochloride?
The IUPAC name of (2-benzyl-1,3-thiazol-4-yl)-(2,9-diazaspiro[4.5]decan-2-yl)methanone;hydrochloride (CID 154889666) is (2-benzyl-1,3-thiazol-4-yl)-(2,9-diazaspiro[4.5]decan-2-yl)methanone;hydrochloride.
What is the SMILES notation for (2-benzyl-1,3-thiazol-4-yl)-(2,9-diazaspiro[4.5]decan-2-yl)methanone;hydrochloride?
The canonical SMILES for (2-benzyl-1,3-thiazol-4-yl)-(2,9-diazaspiro[4.5]decan-2-yl)methanone;hydrochloride is Cl.O=C(c1csc(Cc2ccccc2)n1)N1CCC2(CCCNC2)C1.
What is the InChIKey of (2-benzyl-1,3-thiazol-4-yl)-(2,9-diazaspiro[4.5]decan-2-yl)methanone;hydrochloride?
The InChIKey is FEJFGJFMUOPHPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3OS.ClH/c23-18(22-10-8-19(14-22)7-4-9-20-13-19)16-12-24-17(21-16)11-15-5-2-1-3-6-15;/h1-3,5-6,12,20H,4,7-11,13-14H2;1H.
What are the key properties of (2-benzyl-1,3-thiazol-4-yl)-(2,9-diazaspiro[4.5]decan-2-yl)methanone;hydrochloride?
(2-benzyl-1,3-thiazol-4-yl)-(2,9-diazaspiro[4.5]decan-2-yl)methanone;hydrochloride has a molecular weight of 377.94 g/mol, XLogP of 3.37, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzyl-1,3-thiazol-4-yl)-(2,9-diazaspiro[4.5]decan-2-yl)methanone;hydrochloride is sourced from PubChem (CID 154889666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).