C15H20ClN7S — CID 154889878
N-[2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine;hydrochloride (PubChem CID 154889878) has the molecular formula C15H20ClN7S and a molecular weight of 365.89 g/mol. Its IUPAC name is N-[2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine;hydrochloride.
| Compound Name | N-[2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 154889878 |
| Molecular Formula | C15H20ClN7S |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-[2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine;hydrochloride |
| SMILES | Cc1nn2cc(CCNc3ncnc4c3CCNCC4)nc2s1.Cl |
| InChI | InChI=1S/C15H19N7S.ClH/c1-10-21-22-8-11(20-15(22)23-10)2-7-17-14-12-3-5-16-6-4-13(12)18-9-19-14;/h8-9,16H,2-7H2,1H3,(H,17,18,19);1H |
| InChIKey | PVDJQMHQEBLNEY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 80.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |