C17H19N7OS — CID 171386783
2-cyclopropyl-4-[2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)ethylamino]-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-8-one (PubChem CID 171386783) has the molecular formula C17H19N7OS and a molecular weight of 369.45 g/mol. Its IUPAC name is 2-cyclopropyl-4-[2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)ethylamino]-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-8-one.
| Compound Name | 2-cyclopropyl-4-[2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)ethylamino]-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-8-one |
|---|---|
| PubChem CID | 171386783 |
| Molecular Formula | C17H19N7OS |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 2-cyclopropyl-4-[2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)ethylamino]-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-8-one |
| SMILES | Cc1nn2cc(CCNc3nc(C4CC4)nc4c3CCNC4=O)nc2s1 |
| InChI | InChI=1S/C17H19N7OS/c1-9-23-24-8-11(20-17(24)26-9)4-6-18-15-12-5-7-19-16(25)13(12)21-14(22-15)10-2-3-10/h8,10H,2-7H2,1H3,(H,19,25)(H,18,21,22) |
| InChIKey | NIOOCABKTWQMAP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 97.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |