C12H22ClN5O2S — CID 154894688
N-[2-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]morpholine-2-carboxamide;hydrochloride (PubChem CID 154894688) has the molecular formula C12H22ClN5O2S and a molecular weight of 335.86 g/mol. Its IUPAC name is N-[2-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]morpholine-2-carboxamide;hydrochloride.
| Compound Name | N-[2-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]morpholine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 154894688 |
| Molecular Formula | C12H22ClN5O2S |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N-[2-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]morpholine-2-carboxamide;hydrochloride |
| SMILES | CCn1c(C)nnc1SCCNC(=O)C1CNCCO1.Cl |
| InChI | InChI=1S/C12H21N5O2S.ClH/c1-3-17-9(2)15-16-12(17)20-7-5-14-11(18)10-8-13-4-6-19-10;/h10,13H,3-8H2,1-2H3,(H,14,18);1H |
| InChIKey | DJYQYTSWZUOLOC-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|