C14H24Cl3N3O4S — CID 154895062
4-chloro-N-[2-[(6-hydroxy-1,4-oxazepan-6-yl)methylamino]ethyl]benzenesulfonamide;dihydrochloride (PubChem CID 154895062) has the molecular formula C14H24Cl3N3O4S and a molecular weight of 436.79 g/mol. Its IUPAC name is 4-chloro-N-[2-[(6-hydroxy-1,4-oxazepan-6-yl)methylamino]ethyl]benzenesulfonamide;dihydrochloride.
| Compound Name | 4-chloro-N-[2-[(6-hydroxy-1,4-oxazepan-6-yl)methylamino]ethyl]benzenesulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 154895062 |
| Molecular Formula | C14H24Cl3N3O4S |
| Molecular Weight | 436.79 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 4-chloro-N-[2-[(6-hydroxy-1,4-oxazepan-6-yl)methylamino]ethyl]benzenesulfonamide;dihydrochloride |
| SMILES | Cl.Cl.O=S(=O)(NCCNCC1(O)CNCCOC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H22ClN3O4S.2ClH/c15-12-1-3-13(4-2-12)23(20,21)18-6-5-16-9-14(19)10-17-7-8-22-11-14;;/h1-4,16-19H,5-11H2;2*1H |
| InChIKey | ZYFHSSOLRXELLW-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.79 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|