C18H24ClN5O2 — CID 154895422
1-[1-[1-(2-aminoethyl)triazole-4-carbonyl]piperidin-3-yl]-2-phenylethanone;hydrochloride (PubChem CID 154895422) has the molecular formula C18H24ClN5O2 and a molecular weight of 377.88 g/mol. Its IUPAC name is 1-[1-[1-(2-aminoethyl)triazole-4-carbonyl]piperidin-3-yl]-2-phenylethanone;hydrochloride.
| Compound Name | 1-[1-[1-(2-aminoethyl)triazole-4-carbonyl]piperidin-3-yl]-2-phenylethanone;hydrochloride |
|---|---|
| PubChem CID | 154895422 |
| Molecular Formula | C18H24ClN5O2 |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 1-[1-[1-(2-aminoethyl)triazole-4-carbonyl]piperidin-3-yl]-2-phenylethanone;hydrochloride |
| SMILES | Cl.NCCn1cc(C(=O)N2CCCC(C(=O)Cc3ccccc3)C2)nn1 |
| InChI | InChI=1S/C18H23N5O2.ClH/c19-8-10-23-13-16(20-21-23)18(25)22-9-4-7-15(12-22)17(24)11-14-5-2-1-3-6-14;/h1-3,5-6,13,15H,4,7-12,19H2;1H |
| InChIKey | PKAYSNHMLLUJNO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |