C22H29N5O2 — CID 42112383
[1-[1-(3-phenylpropyl)triazole-4-carbonyl]piperidin-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 42112383) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is [1-[1-(3-phenylpropyl)triazole-4-carbonyl]piperidin-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [1-[1-(3-phenylpropyl)triazole-4-carbonyl]piperidin-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 42112383 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | [1-[1-(3-phenylpropyl)triazole-4-carbonyl]piperidin-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cn(CCCc2ccccc2)nn1)N1CCC(C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C22H29N5O2/c28-21(25-12-4-5-13-25)19-10-15-26(16-11-19)22(29)20-17-27(24-23-20)14-6-9-18-7-2-1-3-8-18/h1-3,7-8,17,19H,4-6,9-16H2 |
| InChIKey | HKEBMVGTFYFNJR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |