C22H31N5O — CID 45216946
[1-[1-(3-phenylpropyl)piperidin-3-yl]triazol-4-yl]-piperidin-1-ylmethanone (PubChem CID 45216946) has the molecular formula C22H31N5O and a molecular weight of 381.52 g/mol. Its IUPAC name is [1-[1-(3-phenylpropyl)piperidin-3-yl]triazol-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [1-[1-(3-phenylpropyl)piperidin-3-yl]triazol-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 45216946 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | [1-[1-(3-phenylpropyl)piperidin-3-yl]triazol-4-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cn(C2CCCN(CCCc3ccccc3)C2)nn1)N1CCCCC1 |
| InChI | InChI=1S/C22H31N5O/c28-22(26-15-5-2-6-16-26)21-18-27(24-23-21)20-12-8-14-25(17-20)13-7-11-19-9-3-1-4-10-19/h1,3-4,9-10,18,20H,2,5-8,11-17H2 |
| InChIKey | LJAAEGYWANWFNW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |