C15H27Cl2N5OS — CID 154895551
N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-2,8-diazaspiro[4.5]decane-3-carboxamide;dihydrochloride (PubChem CID 154895551) has the molecular formula C15H27Cl2N5OS and a molecular weight of 396.39 g/mol. Its IUPAC name is N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-2,8-diazaspiro[4.5]decane-3-carboxamide;dihydrochloride.
| Compound Name | N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-2,8-diazaspiro[4.5]decane-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 154895551 |
| Molecular Formula | C15H27Cl2N5OS |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-2,8-diazaspiro[4.5]decane-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.Cn1ccnc1SCCNC(=O)C1CC2(CCNCC2)CN1 |
| InChI | InChI=1S/C15H25N5OS.2ClH/c1-20-8-6-18-14(20)22-9-7-17-13(21)12-10-15(11-19-12)2-4-16-5-3-15;;/h6,8,12,16,19H,2-5,7,9-11H2,1H3,(H,17,21);2*1H |
| InChIKey | HFECBSQFUDQUIO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|