C14H24N4OS — CID 97138987
(2S)-1-methyl-N-[2-(1-methylimidazol-2-yl)sulfanylethyl]azepane-2-carboxamide (PubChem CID 97138987) has the molecular formula C14H24N4OS and a molecular weight of 296.44 g/mol. Its IUPAC name is (2S)-1-methyl-N-[2-(1-methylimidazol-2-yl)sulfanylethyl]azepane-2-carboxamide.
| Compound Name | (2S)-1-methyl-N-[2-(1-methylimidazol-2-yl)sulfanylethyl]azepane-2-carboxamide |
|---|---|
| PubChem CID | 97138987 |
| Molecular Formula | C14H24N4OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | (2S)-1-methyl-N-[2-(1-methylimidazol-2-yl)sulfanylethyl]azepane-2-carboxamide |
| SMILES | CN1CCCCC[C@H]1C(=O)NCCSc1nccn1C |
| InChI | InChI=1S/C14H24N4OS/c1-17-9-5-3-4-6-12(17)13(19)15-8-11-20-14-16-7-10-18(14)2/h7,10,12H,3-6,8-9,11H2,1-2H3,(H,15,19)/t12-/m0/s1 |
| InChIKey | DSUHTTHYCITFIA-LBPRGKRZSA-N |
| XLogP | 1.50 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|