C31H35N7O4 — CID 15489577
2-N,6-N-bis[(2S)-1-[(2E)-2-benzylidenehydrazinyl]-3-methyl-1-oxobutan-2-yl]pyridine-2,6-dicarboxamide (PubChem CID 15489577) has the molecular formula C31H35N7O4 and a molecular weight of 569.67 g/mol. Its IUPAC name is 2-N,6-N-bis[(2S)-1-[(2E)-2-benzylidenehydrazinyl]-3-methyl-1-oxobutan-2-yl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[(2S)-1-[(2E)-2-benzylidenehydrazinyl]-3-methyl-1-oxobutan-2-yl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 15489577 |
| Molecular Formula | C31H35N7O4 |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | 2-N,6-N-bis[(2S)-1-[(2E)-2-benzylidenehydrazinyl]-3-methyl-1-oxobutan-2-yl]pyridine-2,6-dicarboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1cccc(C(=O)N[C@H](C(=O)N/N=C/c2ccccc2)C(C)C)n1)C(=O)N/N=C/c1ccccc1 |
| InChI | InChI=1S/C31H35N7O4/c1-20(2)26(30(41)37-32-18-22-12-7-5-8-13-22)35-28(39)24-16-11-17-25(34-24)29(40)36-27(21(3)4)31(42)38-33-19-23-14-9-6-10-15-23/h5-21,26-27H,1-4H3,(H,35,39)(H,36,40)(H,37,41)(H,38,42)/b32-18+,33-19+/t26-,27-/m0/s1 |
| InChIKey | PVEWSUJTDCZMTL-ZSFGCHEZSA-N |
| XLogP | 2.89 |
| TPSA | 154.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|