C39H35N7O4 — CID 11802550
2-N,6-N-bis[(2S)-1-[(2E)-2-benzylidenehydrazinyl]-1-oxo-3-phenylpropan-2-yl]pyridine-2,6-dicarboxamide (PubChem CID 11802550) has the molecular formula C39H35N7O4 and a molecular weight of 665.75 g/mol. Its IUPAC name is 2-N,6-N-bis[(2S)-1-[(2E)-2-benzylidenehydrazinyl]-1-oxo-3-phenylpropan-2-yl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[(2S)-1-[(2E)-2-benzylidenehydrazinyl]-1-oxo-3-phenylpropan-2-yl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 11802550 |
| Molecular Formula | C39H35N7O4 |
| Molecular Weight | 665.75 g/mol |
| Exact Mass | 665.28 |
| IUPAC Name | 2-N,6-N-bis[(2S)-1-[(2E)-2-benzylidenehydrazinyl]-1-oxo-3-phenylpropan-2-yl]pyridine-2,6-dicarboxamide |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)N/N=C/c1ccccc1)c1cccc(C(=O)N[C@@H](Cc2ccccc2)C(=O)N/N=C/c2ccccc2)n1 |
| InChI | InChI=1S/C39H35N7O4/c47-36(43-34(24-28-14-5-1-6-15-28)38(49)45-40-26-30-18-9-3-10-19-30)32-22-13-23-33(42-32)37(48)44-35(25-29-16-7-2-8-17-29)39(50)46-41-27-31-20-11-4-12-21-31/h1-23,26-27,34-35H,24-25H2,(H,43,47)(H,44,48)(H,45,49)(H,46,50)/b40-26+,41-27+/t34-,35-/m0/s1 |
| InChIKey | VPYWZJYCHLEFIJ-LSIHIKNPSA-N |
| XLogP | 4.06 |
| TPSA | 154.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.75 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|