C25H23N7O4 — CID 176514703
2-N,6-N-bis[[4-(2-amino-2-oxoethyl)phenyl]methylideneamino]pyridine-2,6-dicarboxamide (PubChem CID 176514703) has the molecular formula C25H23N7O4 and a molecular weight of 485.50 g/mol. Its IUPAC name is 2-N,6-N-bis[[4-(2-amino-2-oxoethyl)phenyl]methylideneamino]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[[4-(2-amino-2-oxoethyl)phenyl]methylideneamino]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 176514703 |
| Molecular Formula | C25H23N7O4 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 2-N,6-N-bis[[4-(2-amino-2-oxoethyl)phenyl]methylideneamino]pyridine-2,6-dicarboxamide |
| SMILES | NC(=O)Cc1ccc(C=NNC(=O)c2cccc(C(=O)NN=Cc3ccc(CC(N)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C25H23N7O4/c26-22(33)12-16-4-8-18(9-5-16)14-28-31-24(35)20-2-1-3-21(30-20)25(36)32-29-15-19-10-6-17(7-11-19)13-23(27)34/h1-11,14-15H,12-13H2,(H2,26,33)(H2,27,34)(H,31,35)(H,32,36) |
| InChIKey | CPFGCMXFEHLCJE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 181.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|