C16H22ClN3O — CID 154896293
3,5,7-trimethyl-N-[(3S)-pyrrolidin-3-yl]-1H-indole-2-carboxamide;hydrochloride (PubChem CID 154896293) has the molecular formula C16H22ClN3O and a molecular weight of 307.83 g/mol. Its IUPAC name is 3,5,7-trimethyl-N-[(3S)-pyrrolidin-3-yl]-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | 3,5,7-trimethyl-N-[(3S)-pyrrolidin-3-yl]-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 154896293 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.83 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 3,5,7-trimethyl-N-[(3S)-pyrrolidin-3-yl]-1H-indole-2-carboxamide;hydrochloride |
| SMILES | Cc1cc(C)c2[nH]c(C(=O)N[C@H]3CCNC3)c(C)c2c1.Cl |
| InChI | InChI=1S/C16H21N3O.ClH/c1-9-6-10(2)14-13(7-9)11(3)15(19-14)16(20)18-12-4-5-17-8-12;/h6-7,12,17,19H,4-5,8H2,1-3H3,(H,18,20);1H/t12-;/m0./s1 |
| InChIKey | DBSGWRVTFKVOLH-YDALLXLXSA-N |
| XLogP | 2.61 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.83 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|