C18H22N4O — CID 46963623
N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3,5,7-trimethyl-1H-indole-2-carboxamide (PubChem CID 46963623) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3,5,7-trimethyl-1H-indole-2-carboxamide.
| Compound Name | N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3,5,7-trimethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 46963623 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3,5,7-trimethyl-1H-indole-2-carboxamide |
| SMILES | Cc1cc(C)c2[nH]c(C(=O)NCc3c(C)n[nH]c3C)c(C)c2c1 |
| InChI | InChI=1S/C18H22N4O/c1-9-6-10(2)16-14(7-9)11(3)17(20-16)18(23)19-8-15-12(4)21-22-13(15)5/h6-7,20H,8H2,1-5H3,(H,19,23)(H,21,22) |
| InChIKey | CWVSDHACABBBJY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|