C22H22N4O2 — CID 16677139
3,5,7-trimethyl-N-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]-1H-indole-2-carboxamide (PubChem CID 16677139) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3,5,7-trimethyl-N-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 3,5,7-trimethyl-N-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 16677139 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 3,5,7-trimethyl-N-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(C)c2[nH]c(C(=O)NCCc3nc(-c4ccccc4)no3)c(C)c2c1 |
| InChI | InChI=1S/C22H22N4O2/c1-13-11-14(2)19-17(12-13)15(3)20(25-19)22(27)23-10-9-18-24-21(26-28-18)16-7-5-4-6-8-16/h4-8,11-12,25H,9-10H2,1-3H3,(H,23,27) |
| InChIKey | LVOQWSITCLTDDE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|