C17H27ClN2O2S — CID 154898027
N-[(3R,4S)-4-cyclopropyl-1-(2-ethoxyethyl)pyrrolidin-3-yl]-2-thiophen-3-ylacetamide;hydrochloride (PubChem CID 154898027) has the molecular formula C17H27ClN2O2S and a molecular weight of 358.94 g/mol. Its IUPAC name is N-[(3R,4S)-4-cyclopropyl-1-(2-ethoxyethyl)pyrrolidin-3-yl]-2-thiophen-3-ylacetamide;hydrochloride.
| Compound Name | N-[(3R,4S)-4-cyclopropyl-1-(2-ethoxyethyl)pyrrolidin-3-yl]-2-thiophen-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 154898027 |
| Molecular Formula | C17H27ClN2O2S |
| Molecular Weight | 358.94 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-[(3R,4S)-4-cyclopropyl-1-(2-ethoxyethyl)pyrrolidin-3-yl]-2-thiophen-3-ylacetamide;hydrochloride |
| SMILES | CCOCCN1C[C@H](NC(=O)Cc2ccsc2)[C@@H](C2CC2)C1.Cl |
| InChI | InChI=1S/C17H26N2O2S.ClH/c1-2-21-7-6-19-10-15(14-3-4-14)16(11-19)18-17(20)9-13-5-8-22-12-13;/h5,8,12,14-16H,2-4,6-7,9-11H2,1H3,(H,18,20);1H/t15-,16+;/m1./s1 |
| InChIKey | LULOQADZDAGSHJ-RCPFAERMSA-N |
| XLogP | 2.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.94 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|