C17H24ClF3N2O2 — CID 154898295
3-hydroxy-N-[(3R,4S)-4-propan-2-yl-1-[(3,4,5-trifluorophenyl)methyl]pyrrolidin-3-yl]propanamide;hydrochloride (PubChem CID 154898295) has the molecular formula C17H24ClF3N2O2 and a molecular weight of 380.84 g/mol. Its IUPAC name is 3-hydroxy-N-[(3R,4S)-4-propan-2-yl-1-[(3,4,5-trifluorophenyl)methyl]pyrrolidin-3-yl]propanamide;hydrochloride.
| Compound Name | 3-hydroxy-N-[(3R,4S)-4-propan-2-yl-1-[(3,4,5-trifluorophenyl)methyl]pyrrolidin-3-yl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 154898295 |
| Molecular Formula | C17H24ClF3N2O2 |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-hydroxy-N-[(3R,4S)-4-propan-2-yl-1-[(3,4,5-trifluorophenyl)methyl]pyrrolidin-3-yl]propanamide;hydrochloride |
| SMILES | CC(C)[C@H]1CN(Cc2cc(F)c(F)c(F)c2)C[C@@H]1NC(=O)CCO.Cl |
| InChI | InChI=1S/C17H23F3N2O2.ClH/c1-10(2)12-8-22(9-15(12)21-16(24)3-4-23)7-11-5-13(18)17(20)14(19)6-11;/h5-6,10,12,15,23H,3-4,7-9H2,1-2H3,(H,21,24);1H/t12-,15+;/m1./s1 |
| InChIKey | QEEQZKOHXOCQTK-YLCXCWDSSA-N |
| XLogP | 2.48 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|