C16H33ClN2O3 — CID 154899569
N-[(3R,4S)-1-(2-ethoxyethyl)-4-propan-2-ylpyrrolidin-3-yl]-2-methoxy-2-methylpropanamide;hydrochloride (PubChem CID 154899569) has the molecular formula C16H33ClN2O3 and a molecular weight of 336.90 g/mol. Its IUPAC name is N-[(3R,4S)-1-(2-ethoxyethyl)-4-propan-2-ylpyrrolidin-3-yl]-2-methoxy-2-methylpropanamide;hydrochloride.
| Compound Name | N-[(3R,4S)-1-(2-ethoxyethyl)-4-propan-2-ylpyrrolidin-3-yl]-2-methoxy-2-methylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 154899569 |
| Molecular Formula | C16H33ClN2O3 |
| Molecular Weight | 336.90 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | N-[(3R,4S)-1-(2-ethoxyethyl)-4-propan-2-ylpyrrolidin-3-yl]-2-methoxy-2-methylpropanamide;hydrochloride |
| SMILES | CCOCCN1C[C@H](NC(=O)C(C)(C)OC)[C@@H](C(C)C)C1.Cl |
| InChI | InChI=1S/C16H32N2O3.ClH/c1-7-21-9-8-18-10-13(12(2)3)14(11-18)17-15(19)16(4,5)20-6;/h12-14H,7-11H2,1-6H3,(H,17,19);1H/t13-,14+;/m1./s1 |
| InChIKey | OPMQNNNGLZOBFG-DFQHDRSWSA-N |
| XLogP | 1.94 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.90 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|