C21H33Cl2N3O2 — CID 154900322
(3aR,6aR)-5-cyclopentyl-N-(2-phenylmethoxyethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide;dihydrochloride (PubChem CID 154900322) has the molecular formula C21H33Cl2N3O2 and a molecular weight of 430.42 g/mol. Its IUPAC name is (3aR,6aR)-5-cyclopentyl-N-(2-phenylmethoxyethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide;dihydrochloride.
| Compound Name | (3aR,6aR)-5-cyclopentyl-N-(2-phenylmethoxyethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 154900322 |
| Molecular Formula | C21H33Cl2N3O2 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (3aR,6aR)-5-cyclopentyl-N-(2-phenylmethoxyethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCOCc1ccccc1)[C@@]12CNC[C@@H]1CN(C1CCCC1)C2 |
| InChI | InChI=1S/C21H31N3O2.2ClH/c25-20(23-10-11-26-14-17-6-2-1-3-7-17)21-15-22-12-18(21)13-24(16-21)19-8-4-5-9-19;;/h1-3,6-7,18-19,22H,4-5,8-16H2,(H,23,25);2*1H/t18-,21-;;/m1../s1 |
| InChIKey | RSTRMVKKLRSOAX-OSBWNOESSA-N |
| XLogP | 2.63 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|