About 1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-3-ylpiperazine;dihydrochloride
1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-3-ylpiperazine;dihydrochloride (PubChem CID 154900689) has the molecular formula C15H23Cl2F2N3
and a molecular weight of 354.27 g/mol. Its IUPAC name is 1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-3-ylpiperazine;dihydrochloride.
Molecular Properties
| Compound Name | 1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-3-ylpiperazine;dihydrochloride |
| PubChem CID | 154900689 |
| Molecular Formula | C15H23Cl2F2N3 |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-3-ylpiperazine;dihydrochloride |
| SMILES | Cl.Cl.Fc1cccc(CN2CCN(C3CCNC3)CC2)c1F |
| InChI | InChI=1S/C15H21F2N3.2ClH/c16-14-3-1-2-12(15(14)17)11-19-6-8-20(9-7-19)13-4-5-18-10-13;;/h1-3,13,18H,4-11H2;2*1H |
| InChIKey | XZUUBRJVGXLFAZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-3-ylpiperazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-3-ylpiperazine;dihydrochloride?
The IUPAC name of 1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-3-ylpiperazine;dihydrochloride (CID 154900689) is 1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-3-ylpiperazine;dihydrochloride.
What is the SMILES notation for 1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-3-ylpiperazine;dihydrochloride?
The canonical SMILES for 1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-3-ylpiperazine;dihydrochloride is Cl.Cl.Fc1cccc(CN2CCN(C3CCNC3)CC2)c1F.
What is the InChIKey of 1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-3-ylpiperazine;dihydrochloride?
The InChIKey is XZUUBRJVGXLFAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F2N3.2ClH/c16-14-3-1-2-12(15(14)17)11-19-6-8-20(9-7-19)13-4-5-18-10-13;;/h1-3,13,18H,4-11H2;2*1H.
What are the key properties of 1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-3-ylpiperazine;dihydrochloride?
1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-3-ylpiperazine;dihydrochloride has a molecular weight of 354.27 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,3-difluorophenyl)methyl]-4-pyrrolidin-3-ylpiperazine;dihydrochloride is sourced from PubChem (CID 154900689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).