C13H20ClN3S — CID 125118001
1-[(5-chlorothiophen-2-yl)methyl]-4-[(3R)-pyrrolidin-3-yl]piperazine (PubChem CID 125118001) has the molecular formula C13H20ClN3S and a molecular weight of 285.84 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-4-[(3R)-pyrrolidin-3-yl]piperazine.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-4-[(3R)-pyrrolidin-3-yl]piperazine |
|---|---|
| PubChem CID | 125118001 |
| Molecular Formula | C13H20ClN3S |
| Molecular Weight | 285.84 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-4-[(3R)-pyrrolidin-3-yl]piperazine |
| SMILES | Clc1ccc(CN2CCN([C@@H]3CCNC3)CC2)s1 |
| InChI | InChI=1S/C13H20ClN3S/c14-13-2-1-12(18-13)10-16-5-7-17(8-6-16)11-3-4-15-9-11/h1-2,11,15H,3-10H2/t11-/m1/s1 |
| InChIKey | MCJDCWRUDHDDNS-LLVKDONJSA-N |
| XLogP | 1.88 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.84 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |