About 2-(2-methylphenyl)-5-[(4-pyrrolidin-3-ylpiperazin-1-yl)methyl]-1,3-thiazole;dihydrochloride
2-(2-methylphenyl)-5-[(4-pyrrolidin-3-ylpiperazin-1-yl)methyl]-1,3-thiazole;dihydrochloride (PubChem CID 154901253) has the molecular formula C19H28Cl2N4S
and a molecular weight of 415.43 g/mol. Its IUPAC name is 2-(2-methylphenyl)-5-[(4-pyrrolidin-3-ylpiperazin-1-yl)methyl]-1,3-thiazole;dihydrochloride.
Molecular Properties
| Compound Name | 2-(2-methylphenyl)-5-[(4-pyrrolidin-3-ylpiperazin-1-yl)methyl]-1,3-thiazole;dihydrochloride |
| PubChem CID | 154901253 |
| Molecular Formula | C19H28Cl2N4S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-(2-methylphenyl)-5-[(4-pyrrolidin-3-ylpiperazin-1-yl)methyl]-1,3-thiazole;dihydrochloride |
| SMILES | Cc1ccccc1-c1ncc(CN2CCN(C3CCNC3)CC2)s1.Cl.Cl |
| InChI | InChI=1S/C19H26N4S.2ClH/c1-15-4-2-3-5-18(15)19-21-13-17(24-19)14-22-8-10-23(11-9-22)16-6-7-20-12-16;;/h2-5,13,16,20H,6-12,14H2,1H3;2*1H |
| InChIKey | RGWRUVXJRIMXTR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-methylphenyl)-5-[(4-pyrrolidin-3-ylpiperazin-1-yl)methyl]-1,3-thiazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylphenyl)-5-[(4-pyrrolidin-3-ylpiperazin-1-yl)methyl]-1,3-thiazole;dihydrochloride?
The IUPAC name of 2-(2-methylphenyl)-5-[(4-pyrrolidin-3-ylpiperazin-1-yl)methyl]-1,3-thiazole;dihydrochloride (CID 154901253) is 2-(2-methylphenyl)-5-[(4-pyrrolidin-3-ylpiperazin-1-yl)methyl]-1,3-thiazole;dihydrochloride.
What is the SMILES notation for 2-(2-methylphenyl)-5-[(4-pyrrolidin-3-ylpiperazin-1-yl)methyl]-1,3-thiazole;dihydrochloride?
The canonical SMILES for 2-(2-methylphenyl)-5-[(4-pyrrolidin-3-ylpiperazin-1-yl)methyl]-1,3-thiazole;dihydrochloride is Cc1ccccc1-c1ncc(CN2CCN(C3CCNC3)CC2)s1.Cl.Cl.
What is the InChIKey of 2-(2-methylphenyl)-5-[(4-pyrrolidin-3-ylpiperazin-1-yl)methyl]-1,3-thiazole;dihydrochloride?
The InChIKey is RGWRUVXJRIMXTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N4S.2ClH/c1-15-4-2-3-5-18(15)19-21-13-17(24-19)14-22-8-10-23(11-9-22)16-6-7-20-12-16;;/h2-5,13,16,20H,6-12,14H2,1H3;2*1H.
What are the key properties of 2-(2-methylphenyl)-5-[(4-pyrrolidin-3-ylpiperazin-1-yl)methyl]-1,3-thiazole;dihydrochloride?
2-(2-methylphenyl)-5-[(4-pyrrolidin-3-ylpiperazin-1-yl)methyl]-1,3-thiazole;dihydrochloride has a molecular weight of 415.43 g/mol, XLogP of 3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylphenyl)-5-[(4-pyrrolidin-3-ylpiperazin-1-yl)methyl]-1,3-thiazole;dihydrochloride is sourced from PubChem (CID 154901253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).