C18H18N4S2 — CID 24917484
6-[[2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 24917484) has the molecular formula C18H18N4S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is 6-[[2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-[[2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24917484 |
| Molecular Formula | C18H18N4S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 6-[[2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | Cc1ccccc1-c1ncc(CN2CCc3[nH]c(=S)ncc3C2)s1 |
| InChI | InChI=1S/C18H18N4S2/c1-12-4-2-3-5-15(12)17-19-9-14(24-17)11-22-7-6-16-13(10-22)8-20-18(23)21-16/h2-5,8-9H,6-7,10-11H2,1H3,(H,20,21,23) |
| InChIKey | CVJCPJVWYKPERL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|