C22H26N4OS — CID 135947634
2-tert-butyl-6-[[2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135947634) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is 2-tert-butyl-6-[[2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-tert-butyl-6-[[2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135947634 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 2-tert-butyl-6-[[2-(2-methylphenyl)-1,3-thiazol-5-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1ccccc1-c1ncc(CN2CCc3nc(C(C)(C)C)[nH]c(=O)c3C2)s1 |
| InChI | InChI=1S/C22H26N4OS/c1-14-7-5-6-8-16(14)20-23-11-15(28-20)12-26-10-9-18-17(13-26)19(27)25-21(24-18)22(2,3)4/h5-8,11H,9-10,12-13H2,1-4H3,(H,24,25,27) |
| InChIKey | DMZHQXQWQBVVGN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |