C13H15N3S2 — CID 24930917
7-[(4-methylthiophen-2-yl)methyl]-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2-thione (PubChem CID 24930917) has the molecular formula C13H15N3S2 and a molecular weight of 277.42 g/mol. Its IUPAC name is 7-[(4-methylthiophen-2-yl)methyl]-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2-thione.
| Compound Name | 7-[(4-methylthiophen-2-yl)methyl]-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24930917 |
| Molecular Formula | C13H15N3S2 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 7-[(4-methylthiophen-2-yl)methyl]-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2-thione |
| SMILES | Cc1csc(CN2CCc3cnc(=S)[nH]c3C2)c1 |
| InChI | InChI=1S/C13H15N3S2/c1-9-4-11(18-8-9)6-16-3-2-10-5-14-13(17)15-12(10)7-16/h4-5,8H,2-3,6-7H2,1H3,(H,14,15,17) |
| InChIKey | FPVOBXPMEVHVSM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|