C15H21ClN4O — CID 154900996
1-(4-cyano-2-ethylphenyl)-3-[(3R)-piperidin-3-yl]urea;hydrochloride (PubChem CID 154900996) has the molecular formula C15H21ClN4O and a molecular weight of 308.81 g/mol. Its IUPAC name is 1-(4-cyano-2-ethylphenyl)-3-[(3R)-piperidin-3-yl]urea;hydrochloride.
| Compound Name | 1-(4-cyano-2-ethylphenyl)-3-[(3R)-piperidin-3-yl]urea;hydrochloride |
|---|---|
| PubChem CID | 154900996 |
| Molecular Formula | C15H21ClN4O |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-(4-cyano-2-ethylphenyl)-3-[(3R)-piperidin-3-yl]urea;hydrochloride |
| SMILES | CCc1cc(C#N)ccc1NC(=O)N[C@@H]1CCCNC1.Cl |
| InChI | InChI=1S/C15H20N4O.ClH/c1-2-12-8-11(9-16)5-6-14(12)19-15(20)18-13-4-3-7-17-10-13;/h5-6,8,13,17H,2-4,7,10H2,1H3,(H2,18,19,20);1H/t13-;/m1./s1 |
| InChIKey | PZXJKBDYTWTRBJ-BTQNPOSSSA-N |
| XLogP | 2.42 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |