C21H33ClN2O2 — CID 154902204
N-[(3-hydroxycyclobutyl)-piperidin-4-ylmethyl]-5-phenylpentanamide;hydrochloride (PubChem CID 154902204) has the molecular formula C21H33ClN2O2 and a molecular weight of 380.96 g/mol. Its IUPAC name is N-[(3-hydroxycyclobutyl)-piperidin-4-ylmethyl]-5-phenylpentanamide;hydrochloride.
| Compound Name | N-[(3-hydroxycyclobutyl)-piperidin-4-ylmethyl]-5-phenylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 154902204 |
| Molecular Formula | C21H33ClN2O2 |
| Molecular Weight | 380.96 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | N-[(3-hydroxycyclobutyl)-piperidin-4-ylmethyl]-5-phenylpentanamide;hydrochloride |
| SMILES | Cl.O=C(CCCCc1ccccc1)NC(C1CCNCC1)C1CC(O)C1 |
| InChI | InChI=1S/C21H32N2O2.ClH/c24-19-14-18(15-19)21(17-10-12-22-13-11-17)23-20(25)9-5-4-8-16-6-2-1-3-7-16;/h1-3,6-7,17-19,21-22,24H,4-5,8-15H2,(H,23,25);1H |
| InChIKey | CPMGILMCNIIHCO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.96 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|