C19H24Cl2F2N6 — CID 154902632
6-(3-aminocyclobutyl)-4-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]pyrimidine-2,4-diamine;dihydrochloride (PubChem CID 154902632) has the molecular formula C19H24Cl2F2N6 and a molecular weight of 445.35 g/mol. Its IUPAC name is 6-(3-aminocyclobutyl)-4-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]pyrimidine-2,4-diamine;dihydrochloride.
| Compound Name | 6-(3-aminocyclobutyl)-4-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]pyrimidine-2,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 154902632 |
| Molecular Formula | C19H24Cl2F2N6 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 6-(3-aminocyclobutyl)-4-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]pyrimidine-2,4-diamine;dihydrochloride |
| SMILES | Cc1[nH]c2c(F)cc(F)cc2c1CCNc1cc(C2CC(N)C2)nc(N)n1.Cl.Cl |
| InChI | InChI=1S/C19H22F2N6.2ClH/c1-9-13(14-6-11(20)7-15(21)18(14)25-9)2-3-24-17-8-16(26-19(23)27-17)10-4-12(22)5-10;;/h6-8,10,12,25H,2-5,22H2,1H3,(H3,23,24,26,27);2*1H |
| InChIKey | ATWJKSIDRVUSCT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|