C15H25Cl2N5O — CID 154903346
1-[4-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]piperidin-1-yl]ethanone;dihydrochloride (PubChem CID 154903346) has the molecular formula C15H25Cl2N5O and a molecular weight of 362.31 g/mol. Its IUPAC name is 1-[4-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]piperidin-1-yl]ethanone;dihydrochloride.
| Compound Name | 1-[4-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]piperidin-1-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 154903346 |
| Molecular Formula | C15H25Cl2N5O |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 1-[4-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]piperidin-1-yl]ethanone;dihydrochloride |
| SMILES | CC(=O)N1CCC(Nc2cc(C3CC(N)C3)ncn2)CC1.Cl.Cl |
| InChI | InChI=1S/C15H23N5O.2ClH/c1-10(21)20-4-2-13(3-5-20)19-15-8-14(17-9-18-15)11-6-12(16)7-11;;/h8-9,11-13H,2-7,16H2,1H3,(H,17,18,19);2*1H |
| InChIKey | JXPAFHHLHSQHKG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |