C17H24N4O3 — CID 154903685
1-cyclopentyl-3-[2-(1-methylbenzimidazol-2-yl)ethyl]urea;formic acid (PubChem CID 154903685) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-(1-methylbenzimidazol-2-yl)ethyl]urea;formic acid.
| Compound Name | 1-cyclopentyl-3-[2-(1-methylbenzimidazol-2-yl)ethyl]urea;formic acid |
|---|---|
| PubChem CID | 154903685 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-cyclopentyl-3-[2-(1-methylbenzimidazol-2-yl)ethyl]urea;formic acid |
| SMILES | Cn1c(CCNC(=O)NC2CCCC2)nc2ccccc21.O=CO |
| InChI | InChI=1S/C16H22N4O.CH2O2/c1-20-14-9-5-4-8-13(14)19-15(20)10-11-17-16(21)18-12-6-2-3-7-12;2-1-3/h4-5,8-9,12H,2-3,6-7,10-11H2,1H3,(H2,17,18,21);1H,(H,2,3) |
| InChIKey | QYHZVCKPPIDFOX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|