C16H21N3OS — CID 90648634
2-(cyclopropylmethylsulfanyl)-N-[2-(1-methylbenzimidazol-2-yl)ethyl]acetamide (PubChem CID 90648634) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 2-(cyclopropylmethylsulfanyl)-N-[2-(1-methylbenzimidazol-2-yl)ethyl]acetamide.
| Compound Name | 2-(cyclopropylmethylsulfanyl)-N-[2-(1-methylbenzimidazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 90648634 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-(cyclopropylmethylsulfanyl)-N-[2-(1-methylbenzimidazol-2-yl)ethyl]acetamide |
| SMILES | Cn1c(CCNC(=O)CSCC2CC2)nc2ccccc21 |
| InChI | InChI=1S/C16H21N3OS/c1-19-14-5-3-2-4-13(14)18-15(19)8-9-17-16(20)11-21-10-12-6-7-12/h2-5,12H,6-11H2,1H3,(H,17,20) |
| InChIKey | XPCOIXMKAYQSSL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |