C16H24Cl2N2O — CID 154904546
[1-[(2-ethyl-1-benzofuran-3-yl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride (PubChem CID 154904546) has the molecular formula C16H24Cl2N2O and a molecular weight of 331.29 g/mol. Its IUPAC name is [1-[(2-ethyl-1-benzofuran-3-yl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride.
| Compound Name | [1-[(2-ethyl-1-benzofuran-3-yl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 154904546 |
| Molecular Formula | C16H24Cl2N2O |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | [1-[(2-ethyl-1-benzofuran-3-yl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride |
| SMILES | CCc1oc2ccccc2c1CN1CCC(CN)C1.Cl.Cl |
| InChI | InChI=1S/C16H22N2O.2ClH/c1-2-15-14(11-18-8-7-12(9-17)10-18)13-5-3-4-6-16(13)19-15;;/h3-6,12H,2,7-11,17H2,1H3;2*1H |
| InChIKey | PHONNZVAJALMAF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |